C29H34ClN5OS — CID 4242291
N-butyl-4-[[4-chloro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 4242291) has the molecular formula C29H34ClN5OS and a molecular weight of 536.15 g/mol. Its IUPAC name is N-butyl-4-[[4-chloro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-butyl-4-[[4-chloro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 4242291 |
| Molecular Formula | C29H34ClN5OS |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | N-butyl-4-[[4-chloro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CSc2nc(Cl)cc(N3CCN(CC=Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H34ClN5OS/c1-2-3-15-31-28(36)25-13-11-24(12-14-25)22-37-29-32-26(30)21-27(33-29)35-19-17-34(18-20-35)16-7-10-23-8-5-4-6-9-23/h4-14,21H,2-3,15-20,22H2,1H3,(H,31,36) |
| InChIKey | ALGXSMFZROIBBK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|