C28H33ClFN5OS — CID 3933447
4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide (PubChem CID 3933447) has the molecular formula C28H33ClFN5OS and a molecular weight of 542.12 g/mol. Its IUPAC name is 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide.
| Compound Name | 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 3933447 |
| Molecular Formula | C28H33ClFN5OS |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1ccc(CSc2nc(Cl)cc(N3CCN(c4ccccc4F)CC3)n2)cc1 |
| InChI | InChI=1S/C28H33ClFN5OS/c1-2-3-4-7-14-31-27(36)22-12-10-21(11-13-22)20-37-28-32-25(29)19-26(33-28)35-17-15-34(16-18-35)24-9-6-5-8-23(24)30/h5-6,8-13,19H,2-4,7,14-18,20H2,1H3,(H,31,36) |
| InChIKey | BGLGFEBYQDPIMU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|