C24H25ClFN5O2S — CID 4039308
4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-ethoxybenzamide (PubChem CID 4039308) has the molecular formula C24H25ClFN5O2S and a molecular weight of 502.02 g/mol. Its IUPAC name is 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-ethoxybenzamide.
| Compound Name | 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-ethoxybenzamide |
|---|---|
| PubChem CID | 4039308 |
| Molecular Formula | C24H25ClFN5O2S |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-[[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-ethoxybenzamide |
| SMILES | CCONC(=O)c1ccc(CSc2nc(Cl)cc(N3CCN(c4ccccc4F)CC3)n2)cc1 |
| InChI | InChI=1S/C24H25ClFN5O2S/c1-2-33-29-23(32)18-9-7-17(8-10-18)16-34-24-27-21(25)15-22(28-24)31-13-11-30(12-14-31)20-6-4-3-5-19(20)26/h3-10,15H,2,11-14,16H2,1H3,(H,29,32) |
| InChIKey | HSTQXOXNAOHWLF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|