C22H20ClFN4OS — CID 42754315
4-[(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylmethyl]-N-(2-fluorophenyl)benzamide (PubChem CID 42754315) has the molecular formula C22H20ClFN4OS and a molecular weight of 442.95 g/mol. Its IUPAC name is 4-[(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylmethyl]-N-(2-fluorophenyl)benzamide.
| Compound Name | 4-[(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylmethyl]-N-(2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 42754315 |
| Molecular Formula | C22H20ClFN4OS |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4-[(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylmethyl]-N-(2-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(CSc2nc(Cl)cc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C22H20ClFN4OS/c23-19-13-20(28-11-3-4-12-28)27-22(26-19)30-14-15-7-9-16(10-8-15)21(29)25-18-6-2-1-5-17(18)24/h1-2,5-10,13H,3-4,11-12,14H2,(H,25,29) |
| InChIKey | KXYISQBPRBGRQN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |