C27H32ClN5OS — CID 42766288
4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butylbenzamide (PubChem CID 42766288) has the molecular formula C27H32ClN5OS and a molecular weight of 510.11 g/mol. Its IUPAC name is 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butylbenzamide.
| Compound Name | 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butylbenzamide |
|---|---|
| PubChem CID | 42766288 |
| Molecular Formula | C27H32ClN5OS |
| Molecular Weight | 510.11 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(CSc2nc(Cl)cc(N3CCN(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C27H32ClN5OS/c1-2-3-13-29-26(34)23-11-9-22(10-12-23)20-35-27-30-24(28)18-25(31-27)33-16-14-32(15-17-33)19-21-7-5-4-6-8-21/h4-12,18H,2-3,13-17,19-20H2,1H3,(H,29,34) |
| InChIKey | FBVULPUHKUHHDQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|