C18H20ClFN4O2S — CID 142704988
ethyl 2-[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetate (PubChem CID 142704988) has the molecular formula C18H20ClFN4O2S and a molecular weight of 410.90 g/mol. Its IUPAC name is ethyl 2-[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 142704988 |
| Molecular Formula | C18H20ClFN4O2S |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | ethyl 2-[4-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc(Cl)cc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C18H20ClFN4O2S/c1-2-26-17(25)12-27-18-21-15(19)11-16(22-18)24-9-7-23(8-10-24)14-6-4-3-5-13(14)20/h3-6,11H,2,7-10,12H2,1H3 |
| InChIKey | ALKRGVXVUQDQPL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |