C12H16ClN3O2S — CID 142704975
ethyl 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 142704975) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is ethyl 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | ethyl 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 142704975 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethyl 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc(Cl)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C12H16ClN3O2S/c1-2-18-11(17)8-19-12-14-9(13)7-10(15-12)16-5-3-4-6-16/h7H,2-6,8H2,1H3 |
| InChIKey | VASBWCGQXXWFMB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |