C15H21ClN4OS — CID 811931
2-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylethanone (PubChem CID 811931) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is 2-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 811931 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CSc1nc(Cl)cc(N2CCCCC2)n1)N1CCCC1 |
| InChI | InChI=1S/C15H21ClN4OS/c16-12-10-13(19-6-2-1-3-7-19)18-15(17-12)22-11-14(21)20-8-4-5-9-20/h10H,1-9,11H2 |
| InChIKey | ZIKJLTDGDCOIKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |