C15H23ClN4OS — CID 42753919
2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-piperidin-1-ylethanone (PubChem CID 42753919) has the molecular formula C15H23ClN4OS and a molecular weight of 342.90 g/mol. Its IUPAC name is 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 42753919 |
| Molecular Formula | C15H23ClN4OS |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-piperidin-1-ylethanone |
| SMILES | CCN(CC)c1cc(Cl)nc(SCC(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C15H23ClN4OS/c1-3-19(4-2)13-10-12(16)17-15(18-13)22-11-14(21)20-8-6-5-7-9-20/h10H,3-9,11H2,1-2H3 |
| InChIKey | QBPLLMOANHABKW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |