C24H30ClN5O2S — CID 42764719
2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-1-[4-(2-ethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 42764719) has the molecular formula C24H30ClN5O2S and a molecular weight of 488.06 g/mol. Its IUPAC name is 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-1-[4-(2-ethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-1-[4-(2-ethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 42764719 |
| Molecular Formula | C24H30ClN5O2S |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-1-[4-(2-ethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCC(=O)N2CCN(c3ccccc3OCC)CC2)n1 |
| InChI | InChI=1S/C24H30ClN5O2S/c1-4-11-29(12-5-2)22-17-21(25)26-24(27-22)33-18-23(31)30-15-13-28(14-16-30)19-9-7-8-10-20(19)32-6-3/h4-5,7-10,17H,1-2,6,11-16,18H2,3H3 |
| InChIKey | VBQDYIJXIOUYCU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|