C14H21ClN4OS — CID 42753920
2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone (PubChem CID 42753920) has the molecular formula C14H21ClN4OS and a molecular weight of 328.87 g/mol. Its IUPAC name is 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 42753920 |
| Molecular Formula | C14H21ClN4OS |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone |
| SMILES | CCN(CC)c1cc(Cl)nc(SCC(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C14H21ClN4OS/c1-3-18(4-2)12-9-11(15)16-14(17-12)21-10-13(20)19-7-5-6-8-19/h9H,3-8,10H2,1-2H3 |
| InChIKey | NKMSHQJZMPSGON-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |