C16H22ClN5O3S — CID 42753909
1-(4-acetylpiperazin-1-yl)-2-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylethanone (PubChem CID 42753909) has the molecular formula C16H22ClN5O3S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 42753909 |
| Molecular Formula | C16H22ClN5O3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylethanone |
| SMILES | CC(=O)N1CCN(C(=O)CSc2nc(Cl)cc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C16H22ClN5O3S/c1-12(23)20-2-4-22(5-3-20)15(24)11-26-16-18-13(17)10-14(19-16)21-6-8-25-9-7-21/h10H,2-9,11H2,1H3 |
| InChIKey | QSIZKXPMSBPPFH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |