C29H36ClN5O3S — CID 5187071
N-(6-aminohexyl)-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 5187071) has the molecular formula C29H36ClN5O3S and a molecular weight of 570.16 g/mol. Its IUPAC name is N-(6-aminohexyl)-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(6-aminohexyl)-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 5187071 |
| Molecular Formula | C29H36ClN5O3S |
| Molecular Weight | 570.16 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N-(6-aminohexyl)-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(c1cc(Cl)nc(SCc3cccc(C(=O)NCCCCCCN)c3)n1)CC2 |
| InChI | InChI=1S/C29H36ClN5O3S/c1-37-24-15-21-10-13-35(18-23(21)16-25(24)38-2)27-17-26(30)33-29(34-27)39-19-20-8-7-9-22(14-20)28(36)32-12-6-4-3-5-11-31/h7-9,14-17H,3-6,10-13,18-19,31H2,1-2H3,(H,32,36) |
| InChIKey | LVCSIPSDPLSHBX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.16 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|