C27H32ClN5O2S — CID 3565030
N-butan-2-yl-3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 3565030) has the molecular formula C27H32ClN5O2S and a molecular weight of 526.11 g/mol. Its IUPAC name is N-butan-2-yl-3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 3565030 |
| Molecular Formula | C27H32ClN5O2S |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-butan-2-yl-3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CSc2nc(Cl)cc(N3CCN(c4ccc(OC)cc4)CC3)n2)c1 |
| InChI | InChI=1S/C27H32ClN5O2S/c1-4-19(2)29-26(34)21-7-5-6-20(16-21)18-36-27-30-24(28)17-25(31-27)33-14-12-32(13-15-33)22-8-10-23(35-3)11-9-22/h5-11,16-17,19H,4,12-15,18H2,1-3H3,(H,29,34) |
| InChIKey | WXKQXUJLQXTUNB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|