C32H43ClN6O2S — CID 3352446
3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-[5-(diethylamino)pentan-2-yl]benzamide (PubChem CID 3352446) has the molecular formula C32H43ClN6O2S and a molecular weight of 611.26 g/mol. Its IUPAC name is 3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-[5-(diethylamino)pentan-2-yl]benzamide.
| Compound Name | 3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-[5-(diethylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 3352446 |
| Molecular Formula | C32H43ClN6O2S |
| Molecular Weight | 611.26 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 3-[[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-[5-(diethylamino)pentan-2-yl]benzamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cccc(CSc2nc(Cl)cc(N3CCN(c4ccc(OC)cc4)CC3)n2)c1 |
| InChI | InChI=1S/C32H43ClN6O2S/c1-5-37(6-2)16-8-9-24(3)34-31(40)26-11-7-10-25(21-26)23-42-32-35-29(33)22-30(36-32)39-19-17-38(18-20-39)27-12-14-28(41-4)15-13-27/h7,10-15,21-22,24H,5-6,8-9,16-20,23H2,1-4H3,(H,34,40) |
| InChIKey | LFGKCFAXWUENOS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.26 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|