C27H28F3N5O2S — CID 42824655
N-cyclopropyl-3-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 42824655) has the molecular formula C27H28F3N5O2S and a molecular weight of 543.62 g/mol. Its IUPAC name is N-cyclopropyl-3-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-cyclopropyl-3-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 42824655 |
| Molecular Formula | C27H28F3N5O2S |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | N-cyclopropyl-3-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | COc1ccc(N2CCN(c3cc(C(F)(F)F)nc(SCc4cccc(C(=O)NC5CC5)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C27H28F3N5O2S/c1-37-22-9-7-21(8-10-22)34-11-13-35(14-12-34)24-16-23(27(28,29)30)32-26(33-24)38-17-18-3-2-4-19(15-18)25(36)31-20-5-6-20/h2-4,7-10,15-16,20H,5-6,11-14,17H2,1H3,(H,31,36) |
| InChIKey | GJSQBEVCBBQVRT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|