C22H27ClN4O2S — CID 3969780
3-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]-N-cyclohexylbenzamide (PubChem CID 3969780) has the molecular formula C22H27ClN4O2S and a molecular weight of 447.00 g/mol. Its IUPAC name is 3-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]-N-cyclohexylbenzamide.
| Compound Name | 3-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 3969780 |
| Molecular Formula | C22H27ClN4O2S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]-N-cyclohexylbenzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(CSc2nc(Cl)cc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H27ClN4O2S/c23-19-14-20(27-9-11-29-12-10-27)26-22(25-19)30-15-16-5-4-6-17(13-16)21(28)24-18-7-2-1-3-8-18/h4-6,13-14,18H,1-3,7-12,15H2,(H,24,28) |
| InChIKey | BRJTUUNJAMULNI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |