C22H29ClN4OS — CID 42754278
3-[[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-cyclohexylbenzamide (PubChem CID 42754278) has the molecular formula C22H29ClN4OS and a molecular weight of 433.02 g/mol. Its IUPAC name is 3-[[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-cyclohexylbenzamide.
| Compound Name | 3-[[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 42754278 |
| Molecular Formula | C22H29ClN4OS |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-cyclohexylbenzamide |
| SMILES | CCCN(C)c1cc(Cl)nc(SCc2cccc(C(=O)NC3CCCCC3)c2)n1 |
| InChI | InChI=1S/C22H29ClN4OS/c1-3-12-27(2)20-14-19(23)25-22(26-20)29-15-16-8-7-9-17(13-16)21(28)24-18-10-5-4-6-11-18/h7-9,13-14,18H,3-6,10-12,15H2,1-2H3,(H,24,28) |
| InChIKey | LRKPHEFMVXXENY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |