C24H28N4OS — CID 46143779
N-ethyl-3-[[4-[methyl(propyl)amino]-6-phenylpyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 46143779) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is N-ethyl-3-[[4-[methyl(propyl)amino]-6-phenylpyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-ethyl-3-[[4-[methyl(propyl)amino]-6-phenylpyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 46143779 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-ethyl-3-[[4-[methyl(propyl)amino]-6-phenylpyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCCN(C)c1cc(-c2ccccc2)nc(SCc2cccc(C(=O)NCC)c2)n1 |
| InChI | InChI=1S/C24H28N4OS/c1-4-14-28(3)22-16-21(19-11-7-6-8-12-19)26-24(27-22)30-17-18-10-9-13-20(15-18)23(29)25-5-2/h6-13,15-16H,4-5,14,17H2,1-3H3,(H,25,29) |
| InChIKey | WQPHOATYYSLHBE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |