C20H17ClN3O2S- — CID 7144727
3-[[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]benzoate (PubChem CID 7144727) has the molecular formula C20H17ClN3O2S- and a molecular weight of 398.90 g/mol. Its IUPAC name is 3-[[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]benzoate.
| Compound Name | 3-[[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7144727 |
| Molecular Formula | C20H17ClN3O2S- |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-[[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]benzoate |
| SMILES | CN(Cc1ccccc1)c1cc(Cl)nc(SCc2cccc(C(=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H18ClN3O2S/c1-24(12-14-6-3-2-4-7-14)18-11-17(21)22-20(23-18)27-13-15-8-5-9-16(10-15)19(25)26/h2-11H,12-13H2,1H3,(H,25,26)/p-1 |
| InChIKey | JQTQJDIFDDQKGK-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |