C17H21ClN4OS — CID 5135355
2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-propylacetamide (PubChem CID 5135355) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-propylacetamide.
| Compound Name | 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 5135355 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nc(Cl)cc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H21ClN4OS/c1-3-9-19-16(23)12-24-17-20-14(18)10-15(21-17)22(2)11-13-7-5-4-6-8-13/h4-8,10H,3,9,11-12H2,1-2H3,(H,19,23) |
| InChIKey | SNLGZSGHXRZNAR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |