C19H25ClN4OS — CID 5099411
2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide (PubChem CID 5099411) has the molecular formula C19H25ClN4OS and a molecular weight of 392.96 g/mol. Its IUPAC name is 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide.
| Compound Name | 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
|---|---|
| PubChem CID | 5099411 |
| Molecular Formula | C19H25ClN4OS |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[4-[benzyl(methyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc(Cl)cc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H25ClN4OS/c1-3-4-8-11-21-18(25)14-26-19-22-16(20)12-17(23-19)24(2)13-15-9-6-5-7-10-15/h5-7,9-10,12H,3-4,8,11,13-14H2,1-2H3,(H,21,25) |
| InChIKey | ZMWAHIMVEPBSIN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|