C16H18ClFN4OS — CID 42754057
2-[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 42754057) has the molecular formula C16H18ClFN4OS and a molecular weight of 368.87 g/mol. Its IUPAC name is 2-[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42754057 |
| Molecular Formula | C16H18ClFN4OS |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[4-chloro-6-[methyl(propyl)amino]pyrimidin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | CCCN(C)c1cc(Cl)nc(SCC(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C16H18ClFN4OS/c1-3-8-22(2)14-9-13(17)20-16(21-14)24-10-15(23)19-12-7-5-4-6-11(12)18/h4-7,9H,3,8,10H2,1-2H3,(H,19,23) |
| InChIKey | PASNXPUSONCWCG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |