C15H16FN3O3S — CID 4556144
2-(4,6-dioxo-1-propylpyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 4556144) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(4,6-dioxo-1-propylpyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(4,6-dioxo-1-propylpyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4556144 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(4,6-dioxo-1-propylpyrimidin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | CCCN1C(=O)CC(=O)N=C1SCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C15H16FN3O3S/c1-2-7-19-14(22)8-12(20)18-15(19)23-9-13(21)17-11-6-4-3-5-10(11)16/h3-6H,2,7-9H2,1H3,(H,17,21) |
| InChIKey | UJMCELQDIDEZEU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|