C20H27ClN4OS — CID 7351315
2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 7351315) has the molecular formula C20H27ClN4OS and a molecular weight of 406.98 g/mol. Its IUPAC name is 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7351315 |
| Molecular Formula | C20H27ClN4OS |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | CCN(CC)c1cc(Cl)nc(SCC(=O)N[C@@H](C)CCc2ccccc2)n1 |
| InChI | InChI=1S/C20H27ClN4OS/c1-4-25(5-2)18-13-17(21)23-20(24-18)27-14-19(26)22-15(3)11-12-16-9-7-6-8-10-16/h6-10,13,15H,4-5,11-12,14H2,1-3H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | RHMSGCCNSLHSCV-HNNXBMFYSA-N |
| XLogP | 4.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |