C30H41N5O2 — CID 46091077
N-[5-(diethylamino)pentan-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-4-carboxamide (PubChem CID 46091077) has the molecular formula C30H41N5O2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-4-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46091077 |
| Molecular Formula | C30H41N5O2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-4-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cc(N2CCN(c3ccc(OC)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C30H41N5O2/c1-5-33(6-2)17-9-10-23(3)31-30(36)27-22-29(32-28-12-8-7-11-26(27)28)35-20-18-34(19-21-35)24-13-15-25(37-4)16-14-24/h7-8,11-16,22-23H,5-6,9-10,17-21H2,1-4H3,(H,31,36) |
| InChIKey | NPXTWGOXYCFYPI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|