C31H32N4O2 — CID 46091052
2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)quinoline-4-carboxamide (PubChem CID 46091052) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)quinoline-4-carboxamide.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46091052 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)quinoline-4-carboxamide |
| SMILES | COc1ccc(N2CCN(c3cc(C(=O)NC4CCCc5ccccc54)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C31H32N4O2/c1-37-24-15-13-23(14-16-24)34-17-19-35(20-18-34)30-21-27(26-10-4-5-11-29(26)32-30)31(36)33-28-12-6-8-22-7-2-3-9-25(22)28/h2-5,7,9-11,13-16,21,28H,6,8,12,17-20H2,1H3,(H,33,36) |
| InChIKey | NHANUCBPXLONAE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|