C10H13NOS — CID 142496325
1-methoxysulfanyl-3,4-dihydro-2H-quinoline (PubChem CID 142496325) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-methoxysulfanyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-methoxysulfanyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 142496325 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 1-methoxysulfanyl-3,4-dihydro-2H-quinoline |
| SMILES | COSN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13NOS/c1-12-13-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | DKKWSVVNPBUCDT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|