C17H27NO — CID 139217240
5-(3,4-dihydro-2H-quinolin-1-yl)-3,5-dimethylhexan-3-ol (PubChem CID 139217240) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-quinolin-1-yl)-3,5-dimethylhexan-3-ol.
| Compound Name | 5-(3,4-dihydro-2H-quinolin-1-yl)-3,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 139217240 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 5-(3,4-dihydro-2H-quinolin-1-yl)-3,5-dimethylhexan-3-ol |
| SMILES | CCC(C)(O)CC(C)(C)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H27NO/c1-5-17(4,19)13-16(2,3)18-12-8-10-14-9-6-7-11-15(14)18/h6-7,9,11,19H,5,8,10,12-13H2,1-4H3 |
| InChIKey | IFYZQSIFRVXNGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |