C17H28NOP — CID 134985582
1-ditert-butylphosphoryl-3,4-dihydro-2H-quinoline (PubChem CID 134985582) has the molecular formula C17H28NOP and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-ditert-butylphosphoryl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-ditert-butylphosphoryl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 134985582 |
| Molecular Formula | C17H28NOP |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-ditert-butylphosphoryl-3,4-dihydro-2H-quinoline |
| SMILES | CC(C)(C)P(=O)(N1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C17H28NOP/c1-16(2,3)20(19,17(4,5)6)18-13-9-11-14-10-7-8-12-15(14)18/h7-8,10,12H,9,11,13H2,1-6H3 |
| InChIKey | HOFLWDJAMZEEDN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|