C18H28N2O2S — CID 75872723
1-(4-benzylpiperidin-1-yl)sulfonyl-3-methylpiperidine (PubChem CID 75872723) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)sulfonyl-3-methylpiperidine.
| Compound Name | 1-(4-benzylpiperidin-1-yl)sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 75872723 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)sulfonyl-3-methylpiperidine |
| SMILES | CC1CCCN(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H28N2O2S/c1-16-6-5-11-20(15-16)23(21,22)19-12-9-18(10-13-19)14-17-7-3-2-4-8-17/h2-4,7-8,16,18H,5-6,9-15H2,1H3 |
| InChIKey | UYJIOZZQQUWIEE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |