C10H21N3O2S — CID 115302221
(3S)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine (PubChem CID 115302221) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is (3S)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115302221 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (3S)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine |
| SMILES | CC1CCCN(S(=O)(=O)N2CC[C@H](N)C2)C1 |
| InChI | InChI=1S/C10H21N3O2S/c1-9-3-2-5-12(7-9)16(14,15)13-6-4-10(11)8-13/h9-10H,2-8,11H2,1H3/t9?,10-/m0/s1 |
| InChIKey | YSHBLIMBUCBGIF-AXDSSHIGSA-N |
| XLogP | -0.00 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |