C10H22ClN3O2S — CID 119962874
(3R)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119962874) has the molecular formula C10H22ClN3O2S and a molecular weight of 283.82 g/mol. Its IUPAC name is (3R)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962874 |
| Molecular Formula | C10H22ClN3O2S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (3R)-1-(3-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CCCN(S(=O)(=O)N2CC[C@@H](N)C2)C1.Cl |
| InChI | InChI=1S/C10H21N3O2S.ClH/c1-9-3-2-5-12(7-9)16(14,15)13-6-4-10(11)8-13;/h9-10H,2-8,11H2,1H3;1H/t9?,10-;/m1./s1 |
| InChIKey | LSAMAWQQMDLGGB-FJYJDOHQSA-N |
| XLogP | 0.42 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |