C19H30N2O2S — CID 39977519
(3S,5S)-1-(4-benzylpiperidin-1-yl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 39977519) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is (3S,5S)-1-(4-benzylpiperidin-1-yl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(4-benzylpiperidin-1-yl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 39977519 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3S,5S)-1-(4-benzylpiperidin-1-yl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C19H30N2O2S/c1-16-12-17(2)15-21(14-16)24(22,23)20-10-8-19(9-11-20)13-18-6-4-3-5-7-18/h3-7,16-17,19H,8-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | AYGXPSZCUWSWHM-IRXDYDNUSA-N |
| XLogP | 3.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |