About 9H-carbazol-3-yl benzoate
9H-carbazol-3-yl benzoate (PubChem CID 142723701) has the molecular formula C19H13NO2
and a molecular weight of 287.32 g/mol. Its IUPAC name is 9H-carbazol-3-yl benzoate.
Molecular Properties
| Compound Name | 9H-carbazol-3-yl benzoate |
| PubChem CID | 142723701 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 9H-carbazol-3-yl benzoate |
| SMILES | O=C(Oc1ccc2[nH]c3ccccc3c2c1)c1ccccc1 |
| InChI | InChI=1S/C19H13NO2/c21-19(13-6-2-1-3-7-13)22-14-10-11-18-16(12-14)15-8-4-5-9-17(15)20-18/h1-12,20H |
| InChIKey | RXKIXVSKTIHMCN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazol-3-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazol-3-yl benzoate?
The IUPAC name of 9H-carbazol-3-yl benzoate (CID 142723701) is 9H-carbazol-3-yl benzoate.
What is the SMILES notation for 9H-carbazol-3-yl benzoate?
The canonical SMILES for 9H-carbazol-3-yl benzoate is O=C(Oc1ccc2[nH]c3ccccc3c2c1)c1ccccc1.
What is the InChIKey of 9H-carbazol-3-yl benzoate?
The InChIKey is RXKIXVSKTIHMCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO2/c21-19(13-6-2-1-3-7-13)22-14-10-11-18-16(12-14)15-8-4-5-9-17(15)20-18/h1-12,20H.
What are the key properties of 9H-carbazol-3-yl benzoate?
9H-carbazol-3-yl benzoate has a molecular weight of 287.32 g/mol, XLogP of 4.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-3-yl benzoate is sourced from PubChem (CID 142723701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).