C21H15NO4 — CID 142723697
9H-carbazol-3-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 142723697) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 9H-carbazol-3-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 9H-carbazol-3-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142723697 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 9H-carbazol-3-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Oc1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C21H15NO4/c23-19-9-5-13(11-20(19)24)6-10-21(25)26-14-7-8-18-16(12-14)15-3-1-2-4-17(15)22-18/h1-12,22-24H/b10-6+ |
| InChIKey | GGVFSOLRALJENZ-UXBLZVDNSA-N |
| XLogP | 4.35 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|