C10H8N4O4 — CID 139345085
2H-tetrazol-5-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 139345085) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2H-tetrazol-5-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 2H-tetrazol-5-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 139345085 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2H-tetrazol-5-yl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Oc1nn[nH]n1 |
| InChI | InChI=1S/C10H8N4O4/c15-7-3-1-6(5-8(7)16)2-4-9(17)18-10-11-13-14-12-10/h1-5,15-16H,(H,11,12,13,14)/b4-2+ |
| InChIKey | FKKWWLJVMJBERU-DUXPYHPUSA-N |
| XLogP | 0.23 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|