About 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate
9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 142723689) has the molecular formula C19H13NO2S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate.
Molecular Properties
| Compound Name | 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate |
| PubChem CID | 142723689 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccsc1)Oc1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C19H13NO2S/c21-19(8-5-13-9-10-23-12-13)22-14-6-7-18-16(11-14)15-3-1-2-4-17(15)20-18/h1-12,20H/b8-5+ |
| InChIKey | MUHDXZCYOAXEDK-VMPITWQZSA-N |
| XLogP | 5.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate?
The IUPAC name of 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate (CID 142723689) is 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate.
What is the SMILES notation for 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate?
The canonical SMILES for 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate is O=C(/C=C/c1ccsc1)Oc1ccc2[nH]c3ccccc3c2c1.
What is the InChIKey of 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate?
The InChIKey is MUHDXZCYOAXEDK-VMPITWQZSA-N. The full InChI is InChI=1S/C19H13NO2S/c21-19(8-5-13-9-10-23-12-13)22-14-6-7-18-16(11-14)15-3-1-2-4-17(15)20-18/h1-12,20H/b8-5+.
What are the key properties of 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate?
9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate has a molecular weight of 319.39 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-3-yl (E)-3-thiophen-3-ylprop-2-enoate is sourced from PubChem (CID 142723689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).