About (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
(5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 6475994) has the molecular formula C20H13NO4S
and a molecular weight of 363.39 g/mol. Its IUPAC name is (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| PubChem CID | 6475994 |
| Molecular Formula | C20H13NO4S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Oc1ccc2c(N=C=S)cccc2c1 |
| InChI | InChI=1S/C20H13NO4S/c22-18-8-4-13(10-19(18)23)5-9-20(24)25-15-6-7-16-14(11-15)2-1-3-17(16)21-12-26/h1-11,22-23H/b9-5+ |
| InChIKey | WDMRQBURZWKYQY-WEVVVXLNSA-N |
| XLogP | 4.60 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The IUPAC name of (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CID 6475994) is (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
What is the SMILES notation for (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The canonical SMILES for (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate is O=C(/C=C/c1ccc(O)c(O)c1)Oc1ccc2c(N=C=S)cccc2c1.
What is the InChIKey of (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The InChIKey is WDMRQBURZWKYQY-WEVVVXLNSA-N. The full InChI is InChI=1S/C20H13NO4S/c22-18-8-4-13(10-19(18)23)5-9-20(24)25-15-6-7-16-14(11-15)2-1-3-17(16)21-12-26/h1-11,22-23H/b9-5+.
What are the key properties of (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
(5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate has a molecular weight of 363.39 g/mol, XLogP of 4.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-isothiocyanatonaphthalen-2-yl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 6475994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).