C10H14N4O2S2 — CID 54959134
N-(2-amino-2-sulfanylideneethyl)-N'-(4-propan-2-yl-1,3-thiazol-2-yl)oxamide (PubChem CID 54959134) has the molecular formula C10H14N4O2S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(4-propan-2-yl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-propan-2-yl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 54959134 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-propan-2-yl-1,3-thiazol-2-yl)oxamide |
| SMILES | CC(C)c1csc(NC(=O)C(=O)NCC(N)=S)n1 |
| InChI | InChI=1S/C10H14N4O2S2/c1-5(2)6-4-18-10(13-6)14-9(16)8(15)12-3-7(11)17/h4-5H,3H2,1-2H3,(H2,11,17)(H,12,15)(H,13,14,16) |
| InChIKey | VVGDSTCIAMRMMX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|