C9H12N4O2S2 — CID 54962805
N'-(2-amino-2-sulfanylideneethyl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxamide (PubChem CID 54962805) has the molecular formula C9H12N4O2S2 and a molecular weight of 272.36 g/mol. Its IUPAC name is N'-(2-amino-2-sulfanylideneethyl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxamide.
| Compound Name | N'-(2-amino-2-sulfanylideneethyl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 54962805 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N'-(2-amino-2-sulfanylideneethyl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxamide |
| SMILES | Cc1csc(CNC(=O)C(=O)NCC(N)=S)n1 |
| InChI | InChI=1S/C9H12N4O2S2/c1-5-4-17-7(13-5)3-12-9(15)8(14)11-2-6(10)16/h4H,2-3H2,1H3,(H2,10,16)(H,11,14)(H,12,15) |
| InChIKey | LJSJEASEALSKJL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|