C9H13N5O2S — CID 43547737
N-(2-amino-2-sulfanylideneethyl)-N'-(3,5-dimethyl-1H-pyrazol-4-yl)oxamide (PubChem CID 43547737) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(3,5-dimethyl-1H-pyrazol-4-yl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(3,5-dimethyl-1H-pyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 43547737 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(3,5-dimethyl-1H-pyrazol-4-yl)oxamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C9H13N5O2S/c1-4-7(5(2)14-13-4)12-9(16)8(15)11-3-6(10)17/h3H2,1-2H3,(H2,10,17)(H,11,15)(H,12,16)(H,13,14) |
| InChIKey | OXVNSBCYVKKPAG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|