C10H18N4O — CID 78951288
3-(3,5-dimethyl-1H-pyrazol-4-yl)-1,1-diethylurea (PubChem CID 78951288) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1,1-diethylurea.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 78951288 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H18N4O/c1-5-14(6-2)10(15)11-9-7(3)12-13-8(9)4/h5-6H2,1-4H3,(H,11,15)(H,12,13) |
| InChIKey | LGENPOCPMJKKJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |