C10H17N3O — CID 43546964
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylbutanamide (PubChem CID 43546964) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylbutanamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 43546964 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H17N3O/c1-5-6(2)10(14)11-9-7(3)12-13-8(9)4/h6H,5H2,1-4H3,(H,11,14)(H,12,13) |
| InChIKey | JKXYCPXWXBKICI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |