C8H14N4S — CID 5270685
1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-ethylthiourea (PubChem CID 5270685) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-ethylthiourea.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-ethylthiourea |
|---|---|
| PubChem CID | 5270685 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1c(C)n[nH]c1C |
| InChI | InChI=1S/C8H14N4S/c1-4-9-8(13)10-7-5(2)11-12-6(7)3/h4H2,1-3H3,(H,11,12)(H2,9,10,13) |
| InChIKey | BHNJYXHSCLPFOK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|