C10H18N4O — CID 43547022
1-tert-butyl-3-(3,5-dimethyl-1H-pyrazol-4-yl)urea (PubChem CID 43547022) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,5-dimethyl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-tert-butyl-3-(3,5-dimethyl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 43547022 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-tert-butyl-3-(3,5-dimethyl-1H-pyrazol-4-yl)urea |
| SMILES | Cc1n[nH]c(C)c1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H18N4O/c1-6-8(7(2)14-13-6)11-9(15)12-10(3,4)5/h1-5H3,(H,13,14)(H2,11,12,15) |
| InChIKey | YQLKQQKSMYLOOX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |