C14H22N2O2S2 — CID 115985890
3-[2-hydroxy-3-[methyl(2-methylsulfanylethyl)amino]propoxy]benzenecarbothioamide (PubChem CID 115985890) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[methyl(2-methylsulfanylethyl)amino]propoxy]benzenecarbothioamide.
| Compound Name | 3-[2-hydroxy-3-[methyl(2-methylsulfanylethyl)amino]propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 115985890 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[2-hydroxy-3-[methyl(2-methylsulfanylethyl)amino]propoxy]benzenecarbothioamide |
| SMILES | CSCCN(C)CC(O)COc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-16(6-7-20-2)9-12(17)10-18-13-5-3-4-11(8-13)14(15)19/h3-5,8,12,17H,6-7,9-10H2,1-2H3,(H2,15,19) |
| InChIKey | RAURUNPILJYKQV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|