C12H15NO2S2 — CID 82178456
3-(2-methylprop-2-enylsulfonylmethyl)benzenecarbothioamide (PubChem CID 82178456) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-(2-methylprop-2-enylsulfonylmethyl)benzenecarbothioamide.
| Compound Name | 3-(2-methylprop-2-enylsulfonylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 82178456 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-(2-methylprop-2-enylsulfonylmethyl)benzenecarbothioamide |
| SMILES | C=C(C)CS(=O)(=O)Cc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C12H15NO2S2/c1-9(2)7-17(14,15)8-10-4-3-5-11(6-10)12(13)16/h3-6H,1,7-8H2,2H3,(H2,13,16) |
| InChIKey | SHWZHOJKQZFDNJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|