C16H10BF3O5 — CID 10712802
[9-oxo-7-[(2,2,2-trifluoroacetyl)oxymethyl]fluoren-3-yl]boronic acid (PubChem CID 10712802) has the molecular formula C16H10BF3O5 and a molecular weight of 350.06 g/mol. Its IUPAC name is [9-oxo-7-[(2,2,2-trifluoroacetyl)oxymethyl]fluoren-3-yl]boronic acid.
| Compound Name | [9-oxo-7-[(2,2,2-trifluoroacetyl)oxymethyl]fluoren-3-yl]boronic acid |
|---|---|
| PubChem CID | 10712802 |
| Molecular Formula | C16H10BF3O5 |
| Molecular Weight | 350.06 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [9-oxo-7-[(2,2,2-trifluoroacetyl)oxymethyl]fluoren-3-yl]boronic acid |
| SMILES | O=C1c2cc(COC(=O)C(F)(F)F)ccc2-c2cc(B(O)O)ccc21 |
| InChI | InChI=1S/C16H10BF3O5/c18-16(19,20)15(22)25-7-8-1-3-10-12-6-9(17(23)24)2-4-11(12)14(21)13(10)5-8/h1-6,23-24H,7H2 |
| InChIKey | QUMLBSQLGWXKMG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.06 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|