C16H12O4 — CID 68533927
2,6-bis(hydroxymethyl)anthracene-9,10-dione (PubChem CID 68533927) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)anthracene-9,10-dione.
| Compound Name | 2,6-bis(hydroxymethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 68533927 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2,6-bis(hydroxymethyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccc(CO)cc2C(=O)c2ccc(CO)cc21 |
| InChI | InChI=1S/C16H12O4/c17-7-9-1-3-11-13(5-9)16(20)12-4-2-10(8-18)6-14(12)15(11)19/h1-6,17-18H,7-8H2 |
| InChIKey | CQHWWWBTONMHMO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|